C21H21F2N3O2 — CID 120736568
1-(4-fluorophenyl)-3-[2-(3-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 120736568) has the molecular formula C21H21F2N3O2 and a molecular weight of 385.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-(3-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(4-fluorophenyl)-3-[2-(3-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 120736568 |
| Molecular Formula | C21H21F2N3O2 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-(3-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1C(C(=O)N2CCNCC2c2cccc(F)c2)CCN1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21F2N3O2/c22-15-4-6-17(7-5-15)25-10-8-18(20(25)27)21(28)26-11-9-24-13-19(26)14-2-1-3-16(23)12-14/h1-7,12,18-19,24H,8-11,13H2 |
| InChIKey | PQYIFWSERLIKAS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|