C18H25ClN2O2S — CID 120738860
1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(oxan-2-ylmethylsulfanyl)ethanone (PubChem CID 120738860) has the molecular formula C18H25ClN2O2S and a molecular weight of 368.93 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(oxan-2-ylmethylsulfanyl)ethanone.
| Compound Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(oxan-2-ylmethylsulfanyl)ethanone |
|---|---|
| PubChem CID | 120738860 |
| Molecular Formula | C18H25ClN2O2S |
| Molecular Weight | 368.93 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(oxan-2-ylmethylsulfanyl)ethanone |
| SMILES | O=C(CSCC1CCCCO1)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C18H25ClN2O2S/c19-16-7-2-1-6-15(16)17-11-20-8-9-21(17)18(22)13-24-12-14-5-3-4-10-23-14/h1-2,6-7,14,17,20H,3-5,8-13H2 |
| InChIKey | SIYRGLMHLUTQFF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.93 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |