C19H26ClN5O3 — CID 120740217
1-[2-(4-ethylphenyl)piperazin-1-yl]-3-(2-methyl-4-nitroimidazol-1-yl)propan-1-one;hydrochloride (PubChem CID 120740217) has the molecular formula C19H26ClN5O3 and a molecular weight of 407.90 g/mol. Its IUPAC name is 1-[2-(4-ethylphenyl)piperazin-1-yl]-3-(2-methyl-4-nitroimidazol-1-yl)propan-1-one;hydrochloride.
| Compound Name | 1-[2-(4-ethylphenyl)piperazin-1-yl]-3-(2-methyl-4-nitroimidazol-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120740217 |
| Molecular Formula | C19H26ClN5O3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-[2-(4-ethylphenyl)piperazin-1-yl]-3-(2-methyl-4-nitroimidazol-1-yl)propan-1-one;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)CCn2cc([N+](=O)[O-])nc2C)cc1.Cl |
| InChI | InChI=1S/C19H25N5O3.ClH/c1-3-15-4-6-16(7-5-15)17-12-20-9-11-23(17)19(25)8-10-22-13-18(24(26)27)21-14(22)2;/h4-7,13,17,20H,3,8-12H2,1-2H3;1H |
| InChIKey | CIFFDXJSYAWICM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|