C20H23ClN4O — CID 120741702
[2-(4-ethylphenyl)piperazin-1-yl]-(1H-indazol-3-yl)methanone;hydrochloride (PubChem CID 120741702) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is [2-(4-ethylphenyl)piperazin-1-yl]-(1H-indazol-3-yl)methanone;hydrochloride.
| Compound Name | [2-(4-ethylphenyl)piperazin-1-yl]-(1H-indazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120741702 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [2-(4-ethylphenyl)piperazin-1-yl]-(1H-indazol-3-yl)methanone;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)c2n[nH]c3ccccc23)cc1.Cl |
| InChI | InChI=1S/C20H22N4O.ClH/c1-2-14-7-9-15(10-8-14)18-13-21-11-12-24(18)20(25)19-16-5-3-4-6-17(16)22-23-19;/h3-10,18,21H,2,11-13H2,1H3,(H,22,23);1H |
| InChIKey | ZIJQSKCUIVAZNN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |