C19H33Cl2N3OS — CID 120742801
1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-2-[2-(diethylamino)ethylsulfanyl]ethanone;dihydrochloride (PubChem CID 120742801) has the molecular formula C19H33Cl2N3OS and a molecular weight of 422.47 g/mol. Its IUPAC name is 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-2-[2-(diethylamino)ethylsulfanyl]ethanone;dihydrochloride.
| Compound Name | 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-2-[2-(diethylamino)ethylsulfanyl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 120742801 |
| Molecular Formula | C19H33Cl2N3OS |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-2-[2-(diethylamino)ethylsulfanyl]ethanone;dihydrochloride |
| SMILES | CCN(CC)CCSCC(=O)N1C[C@@H](CN)[C@H](c2ccccc2)C1.Cl.Cl |
| InChI | InChI=1S/C19H31N3OS.2ClH/c1-3-21(4-2)10-11-24-15-19(23)22-13-17(12-20)18(14-22)16-8-6-5-7-9-16;;/h5-9,17-18H,3-4,10-15,20H2,1-2H3;2*1H/t17-,18+;;/m1../s1 |
| InChIKey | LMLOCRKWWGTUFN-WCRQIBMVSA-N |
| XLogP | 3.11 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|