C10H20N6 — CID 120762427
1-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-2,3-dimethylguanidine (PubChem CID 120762427) has the molecular formula C10H20N6 and a molecular weight of 224.31 g/mol. Its IUPAC name is 1-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-2,3-dimethylguanidine.
| Compound Name | 1-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 120762427 |
| Molecular Formula | C10H20N6 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 1-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCc1ncnn1C(C)(C)C |
| InChI | InChI=1S/C10H20N6/c1-10(2,3)16-8(14-7-15-16)6-13-9(11-4)12-5/h7H,6H2,1-5H3,(H2,11,12,13) |
| InChIKey | KGDXRRKYZOOJFG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|