C17H22N4O3S2 — CID 120764100
N-[2-[5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylthiophen-2-yl]ethyl]acetamide (PubChem CID 120764100) has the molecular formula C17H22N4O3S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[2-[5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylthiophen-2-yl]ethyl]acetamide.
| Compound Name | N-[2-[5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylthiophen-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 120764100 |
| Molecular Formula | C17H22N4O3S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-[2-[5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylthiophen-2-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(S(=O)(=O)N2CCNCC2c2cccnc2)s1 |
| InChI | InChI=1S/C17H22N4O3S2/c1-13(22)20-8-6-15-4-5-17(25-15)26(23,24)21-10-9-19-12-16(21)14-3-2-7-18-11-14/h2-5,7,11,16,19H,6,8-10,12H2,1H3,(H,20,22) |
| InChIKey | NTZILPBFONEIFZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |