C15H15FN4O4S — CID 120764186
1-(2-fluoro-6-nitrophenyl)sulfonyl-2-pyridin-3-ylpiperazine (PubChem CID 120764186) has the molecular formula C15H15FN4O4S and a molecular weight of 366.37 g/mol. Its IUPAC name is 1-(2-fluoro-6-nitrophenyl)sulfonyl-2-pyridin-3-ylpiperazine.
| Compound Name | 1-(2-fluoro-6-nitrophenyl)sulfonyl-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120764186 |
| Molecular Formula | C15H15FN4O4S |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 1-(2-fluoro-6-nitrophenyl)sulfonyl-2-pyridin-3-ylpiperazine |
| SMILES | O=[N+]([O-])c1cccc(F)c1S(=O)(=O)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C15H15FN4O4S/c16-12-4-1-5-13(20(21)22)15(12)25(23,24)19-8-7-18-10-14(19)11-3-2-6-17-9-11/h1-6,9,14,18H,7-8,10H2 |
| InChIKey | BCGUSJNZSFJINF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|