C16H21FN4O3S — CID 120764617
2-(3-fluorophenyl)-1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonylpiperazine (PubChem CID 120764617) has the molecular formula C16H21FN4O3S and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonylpiperazine.
| Compound Name | 2-(3-fluorophenyl)-1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonylpiperazine |
|---|---|
| PubChem CID | 120764617 |
| Molecular Formula | C16H21FN4O3S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-(3-fluorophenyl)-1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonylpiperazine |
| SMILES | COCCn1cc(S(=O)(=O)N2CCNCC2c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C16H21FN4O3S/c1-24-8-7-20-12-15(10-19-20)25(22,23)21-6-5-18-11-16(21)13-3-2-4-14(17)9-13/h2-4,9-10,12,16,18H,5-8,11H2,1H3 |
| InChIKey | JHNPGPUSNMCWAT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |