C18H19ClN2O3S — CID 120765181
2-(2-chlorophenyl)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazine (PubChem CID 120765181) has the molecular formula C18H19ClN2O3S and a molecular weight of 378.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazine.
| Compound Name | 2-(2-chlorophenyl)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazine |
|---|---|
| PubChem CID | 120765181 |
| Molecular Formula | C18H19ClN2O3S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazine |
| SMILES | O=S(=O)(c1ccc2c(c1)CCO2)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C18H19ClN2O3S/c19-16-4-2-1-3-15(16)17-12-20-8-9-21(17)25(22,23)14-5-6-18-13(11-14)7-10-24-18/h1-6,11,17,20H,7-10,12H2 |
| InChIKey | CTYQSAHJUAWRGT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |