C17H18Cl2N2O4S — CID 120765302
1-(1,3-benzodioxol-5-ylsulfonyl)-2-(2-chlorophenyl)piperazine;hydrochloride (PubChem CID 120765302) has the molecular formula C17H18Cl2N2O4S and a molecular weight of 417.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylsulfonyl)-2-(2-chlorophenyl)piperazine;hydrochloride.
| Compound Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-2-(2-chlorophenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120765302 |
| Molecular Formula | C17H18Cl2N2O4S |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-2-(2-chlorophenyl)piperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc2c(c1)OCO2)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C17H17ClN2O4S.ClH/c18-14-4-2-1-3-13(14)15-10-19-7-8-20(15)25(21,22)12-5-6-16-17(9-12)24-11-23-16;/h1-6,9,15,19H,7-8,10-11H2;1H |
| InChIKey | LHOYCOGLHUNIAQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |