C14H20Cl2N2O2S — CID 120765152
2-(2-chlorophenyl)-1-(cyclopropylmethylsulfonyl)piperazine;hydrochloride (PubChem CID 120765152) has the molecular formula C14H20Cl2N2O2S and a molecular weight of 351.30 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(cyclopropylmethylsulfonyl)piperazine;hydrochloride.
| Compound Name | 2-(2-chlorophenyl)-1-(cyclopropylmethylsulfonyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120765152 |
| Molecular Formula | C14H20Cl2N2O2S |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(cyclopropylmethylsulfonyl)piperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(CC1CC1)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C14H19ClN2O2S.ClH/c15-13-4-2-1-3-12(13)14-9-16-7-8-17(14)20(18,19)10-11-5-6-11;/h1-4,11,14,16H,5-10H2;1H |
| InChIKey | RVDZUIOUXCDKPE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |