C16H23Cl2N3O2S — CID 120765026
2-[2-(2-chlorophenyl)piperazin-1-yl]sulfonyl-2-azabicyclo[2.2.1]heptane;hydrochloride (PubChem CID 120765026) has the molecular formula C16H23Cl2N3O2S and a molecular weight of 392.35 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)piperazin-1-yl]sulfonyl-2-azabicyclo[2.2.1]heptane;hydrochloride.
| Compound Name | 2-[2-(2-chlorophenyl)piperazin-1-yl]sulfonyl-2-azabicyclo[2.2.1]heptane;hydrochloride |
|---|---|
| PubChem CID | 120765026 |
| Molecular Formula | C16H23Cl2N3O2S |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-[2-(2-chlorophenyl)piperazin-1-yl]sulfonyl-2-azabicyclo[2.2.1]heptane;hydrochloride |
| SMILES | Cl.O=S(=O)(N1CC2CCC1C2)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C16H22ClN3O2S.ClH/c17-15-4-2-1-3-14(15)16-10-18-7-8-19(16)23(21,22)20-11-12-5-6-13(20)9-12;/h1-4,12-13,16,18H,5-11H2;1H |
| InChIKey | BQIXGZKTVZWVJO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |