C13H19Cl2FN2O2S — CID 120765122
2-(2-chlorophenyl)-1-(3-fluoropropylsulfonyl)piperazine;hydrochloride (PubChem CID 120765122) has the molecular formula C13H19Cl2FN2O2S and a molecular weight of 357.28 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(3-fluoropropylsulfonyl)piperazine;hydrochloride.
| Compound Name | 2-(2-chlorophenyl)-1-(3-fluoropropylsulfonyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120765122 |
| Molecular Formula | C13H19Cl2FN2O2S |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(3-fluoropropylsulfonyl)piperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(CCCF)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C13H18ClFN2O2S.ClH/c14-12-5-2-1-4-11(12)13-10-16-7-8-17(13)20(18,19)9-3-6-15;/h1-2,4-5,13,16H,3,6-10H2;1H |
| InChIKey | KPAMMGJNLUUQNM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |