C15H22ClN3O2S — CID 120765131
2-(2-chlorophenyl)-1-piperidin-1-ylsulfonylpiperazine (PubChem CID 120765131) has the molecular formula C15H22ClN3O2S and a molecular weight of 343.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-piperidin-1-ylsulfonylpiperazine.
| Compound Name | 2-(2-chlorophenyl)-1-piperidin-1-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 120765131 |
| Molecular Formula | C15H22ClN3O2S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-(2-chlorophenyl)-1-piperidin-1-ylsulfonylpiperazine |
| SMILES | O=S(=O)(N1CCCCC1)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C15H22ClN3O2S/c16-14-7-3-2-6-13(14)15-12-17-8-11-19(15)22(20,21)18-9-4-1-5-10-18/h2-3,6-7,15,17H,1,4-5,8-12H2 |
| InChIKey | KJFSVBJUNXLKDH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |