C16H24ClN3O — CID 120772224
2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[1-(4-chlorophenyl)ethyl]acetamide (PubChem CID 120772224) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[1-(4-chlorophenyl)ethyl]acetamide.
| Compound Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[1-(4-chlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 120772224 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[1-(4-chlorophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN1CCC(C)(CN)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClN3O/c1-12(13-3-5-14(17)6-4-13)19-15(21)9-20-8-7-16(2,10-18)11-20/h3-6,12H,7-11,18H2,1-2H3,(H,19,21) |
| InChIKey | YLNGUTSGTJSNPH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |