About 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride
3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride (PubChem CID 120775156) has the molecular formula C19H27ClN2O
and a molecular weight of 334.89 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride |
| PubChem CID | 120775156 |
| Molecular Formula | C19H27ClN2O |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride |
| SMILES | CC1(C)CN(CCOc2ccc3ccccc3c2)CCC1N.Cl |
| InChI | InChI=1S/C19H26N2O.ClH/c1-19(2)14-21(10-9-18(19)20)11-12-22-17-8-7-15-5-3-4-6-16(15)13-17;/h3-8,13,18H,9-12,14,20H2,1-2H3;1H |
| InChIKey | ZWORYSKTNUXFEA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride?
The IUPAC name of 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride (CID 120775156) is 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride.
What is the SMILES notation for 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride?
The canonical SMILES for 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride is CC1(C)CN(CCOc2ccc3ccccc3c2)CCC1N.Cl.
What is the InChIKey of 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride?
The InChIKey is ZWORYSKTNUXFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O.ClH/c1-19(2)14-21(10-9-18(19)20)11-12-22-17-8-7-15-5-3-4-6-16(15)13-17;/h3-8,13,18H,9-12,14,20H2,1-2H3;1H.
What are the key properties of 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride?
3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride has a molecular weight of 334.89 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-(2-naphthalen-2-yloxyethyl)piperidin-4-amine;hydrochloride is sourced from PubChem (CID 120775156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).