C14H19FN2O4S — CID 120777652
methyl 3-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-5-fluorobenzoate (PubChem CID 120777652) has the molecular formula C14H19FN2O4S and a molecular weight of 330.38 g/mol. Its IUPAC name is methyl 3-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-5-fluorobenzoate.
| Compound Name | methyl 3-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-5-fluorobenzoate |
|---|---|
| PubChem CID | 120777652 |
| Molecular Formula | C14H19FN2O4S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | methyl 3-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-5-fluorobenzoate |
| SMILES | COC(=O)c1cc(F)cc(S(=O)(=O)N2CCC(C)(CN)C2)c1 |
| InChI | InChI=1S/C14H19FN2O4S/c1-14(8-16)3-4-17(9-14)22(19,20)12-6-10(13(18)21-2)5-11(15)7-12/h5-7H,3-4,8-9,16H2,1-2H3 |
| InChIKey | VEWHLHNXZHILGB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |