C19H28N4O4 — CID 120785442
2-amino-2-(oxan-4-yl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]acetamide (PubChem CID 120785442) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-amino-2-(oxan-4-yl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-amino-2-(oxan-4-yl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 120785442 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 2-amino-2-(oxan-4-yl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]acetamide |
| SMILES | NC(C(=O)Nc1ccc(NC(=O)NCC2CCCO2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C19H28N4O4/c20-17(13-7-10-26-11-8-13)18(24)22-14-3-5-15(6-4-14)23-19(25)21-12-16-2-1-9-27-16/h3-6,13,16-17H,1-2,7-12,20H2,(H,22,24)(H2,21,23,25) |
| InChIKey | OEKUFIJUZGMNRV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |