C16H23Cl2N3O3 — CID 120785571
N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-4-chlorobenzamide;hydrochloride (PubChem CID 120785571) has the molecular formula C16H23Cl2N3O3 and a molecular weight of 376.28 g/mol. Its IUPAC name is N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-4-chlorobenzamide;hydrochloride.
| Compound Name | N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-4-chlorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 120785571 |
| Molecular Formula | C16H23Cl2N3O3 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-4-chlorobenzamide;hydrochloride |
| SMILES | Cl.NC(C(=O)NCCNC(=O)c1ccc(Cl)cc1)C1CCOCC1 |
| InChI | InChI=1S/C16H22ClN3O3.ClH/c17-13-3-1-12(2-4-13)15(21)19-7-8-20-16(22)14(18)11-5-9-23-10-6-11;/h1-4,11,14H,5-10,18H2,(H,19,21)(H,20,22);1H |
| InChIKey | MQTKUTLHKWOBGC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|