C17H24FN3O3 — CID 120785624
N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 120785624) has the molecular formula C17H24FN3O3 and a molecular weight of 337.40 g/mol. Its IUPAC name is N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 120785624 |
| Molecular Formula | C17H24FN3O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)C(N)C2CCOCC2)cc1F |
| InChI | InChI=1S/C17H24FN3O3/c1-11-2-3-13(10-14(11)18)16(22)20-6-7-21-17(23)15(19)12-4-8-24-9-5-12/h2-3,10,12,15H,4-9,19H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | BRDFWTFODVWUMQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|