C16H22BrN3O3 — CID 120791326
N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-3-bromobenzamide (PubChem CID 120791326) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-3-bromobenzamide.
| Compound Name | N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 120791326 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-[2-[[2-amino-2-(oxan-4-yl)acetyl]amino]ethyl]-3-bromobenzamide |
| SMILES | NC(C(=O)NCCNC(=O)c1cccc(Br)c1)C1CCOCC1 |
| InChI | InChI=1S/C16H22BrN3O3/c17-13-3-1-2-12(10-13)15(21)19-6-7-20-16(22)14(18)11-4-8-23-9-5-11/h1-3,10-11,14H,4-9,18H2,(H,19,21)(H,20,22) |
| InChIKey | KZDITQIJCUZPTG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|