C16H24BrN3O2 — CID 119763919
N-[3-[[(2S)-2-amino-4-methylpentanoyl]amino]propyl]-3-bromobenzamide (PubChem CID 119763919) has the molecular formula C16H24BrN3O2 and a molecular weight of 370.29 g/mol. Its IUPAC name is N-[3-[[(2S)-2-amino-4-methylpentanoyl]amino]propyl]-3-bromobenzamide.
| Compound Name | N-[3-[[(2S)-2-amino-4-methylpentanoyl]amino]propyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 119763919 |
| Molecular Formula | C16H24BrN3O2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[3-[[(2S)-2-amino-4-methylpentanoyl]amino]propyl]-3-bromobenzamide |
| SMILES | CC(C)C[C@H](N)C(=O)NCCCNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H24BrN3O2/c1-11(2)9-14(18)16(22)20-8-4-7-19-15(21)12-5-3-6-13(17)10-12/h3,5-6,10-11,14H,4,7-9,18H2,1-2H3,(H,19,21)(H,20,22)/t14-/m0/s1 |
| InChIKey | BTVZFMXBIGYIKL-AWEZNQCLSA-N |
| XLogP | 2.06 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|