C15H22ClN3O4S — CID 120785640
2-amino-N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-(oxan-4-yl)acetamide (PubChem CID 120785640) has the molecular formula C15H22ClN3O4S and a molecular weight of 375.88 g/mol. Its IUPAC name is 2-amino-N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120785640 |
| Molecular Formula | C15H22ClN3O4S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-amino-N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-(oxan-4-yl)acetamide |
| SMILES | NC(C(=O)NCCNS(=O)(=O)c1cccc(Cl)c1)C1CCOCC1 |
| InChI | InChI=1S/C15H22ClN3O4S/c16-12-2-1-3-13(10-12)24(21,22)19-7-6-18-15(20)14(17)11-4-8-23-9-5-11/h1-3,10-11,14,19H,4-9,17H2,(H,18,20) |
| InChIKey | FPZWTXZZGLQDFA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|