C15H20F2N2O2 — CID 120793248
2-amino-N-[2-(2,3-difluorophenyl)ethyl]-2-(oxan-4-yl)acetamide (PubChem CID 120793248) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-amino-N-[2-(2,3-difluorophenyl)ethyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[2-(2,3-difluorophenyl)ethyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120793248 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-amino-N-[2-(2,3-difluorophenyl)ethyl]-2-(oxan-4-yl)acetamide |
| SMILES | NC(C(=O)NCCc1cccc(F)c1F)C1CCOCC1 |
| InChI | InChI=1S/C15H20F2N2O2/c16-12-3-1-2-10(13(12)17)4-7-19-15(20)14(18)11-5-8-21-9-6-11/h1-3,11,14H,4-9,18H2,(H,19,20) |
| InChIKey | PTAITCHXCRTASE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |