C12H14ClF3N2O2 — CID 120786075
(2S,5R)-5-(aminomethyl)-N-(2,4,5-trifluorophenyl)oxolane-2-carboxamide;hydrochloride (PubChem CID 120786075) has the molecular formula C12H14ClF3N2O2 and a molecular weight of 310.70 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(2,4,5-trifluorophenyl)oxolane-2-carboxamide;hydrochloride.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(2,4,5-trifluorophenyl)oxolane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120786075 |
| Molecular Formula | C12H14ClF3N2O2 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(2,4,5-trifluorophenyl)oxolane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC[C@H]1CC[C@@H](C(=O)Nc2cc(F)c(F)cc2F)O1 |
| InChI | InChI=1S/C12H13F3N2O2.ClH/c13-7-3-9(15)10(4-8(7)14)17-12(18)11-2-1-6(5-16)19-11;/h3-4,6,11H,1-2,5,16H2,(H,17,18);1H/t6-,11+;/m1./s1 |
| InChIKey | VHQZEZOMIHMRER-MMAOGJFZSA-N |
| XLogP | 1.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|