C16H20N4O2 — CID 120788956
(2S,5R)-5-(aminomethyl)-N-(1-benzylpyrazol-4-yl)oxolane-2-carboxamide (PubChem CID 120788956) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(1-benzylpyrazol-4-yl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(1-benzylpyrazol-4-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120788956 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(1-benzylpyrazol-4-yl)oxolane-2-carboxamide |
| SMILES | NC[C@H]1CC[C@@H](C(=O)Nc2cnn(Cc3ccccc3)c2)O1 |
| InChI | InChI=1S/C16H20N4O2/c17-8-14-6-7-15(22-14)16(21)19-13-9-18-20(11-13)10-12-4-2-1-3-5-12/h1-5,9,11,14-15H,6-8,10,17H2,(H,19,21)/t14-,15+/m1/s1 |
| InChIKey | VIDCVKFYIDWSIT-CABCVRRESA-N |
| XLogP | 1.38 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |