C14H27ClN2O3 — CID 120789971
2-amino-1-(2-ethyl-6-methylmorpholin-4-yl)-2-(oxan-4-yl)ethanone;hydrochloride (PubChem CID 120789971) has the molecular formula C14H27ClN2O3 and a molecular weight of 306.83 g/mol. Its IUPAC name is 2-amino-1-(2-ethyl-6-methylmorpholin-4-yl)-2-(oxan-4-yl)ethanone;hydrochloride.
| Compound Name | 2-amino-1-(2-ethyl-6-methylmorpholin-4-yl)-2-(oxan-4-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120789971 |
| Molecular Formula | C14H27ClN2O3 |
| Molecular Weight | 306.83 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-amino-1-(2-ethyl-6-methylmorpholin-4-yl)-2-(oxan-4-yl)ethanone;hydrochloride |
| SMILES | CCC1CN(C(=O)C(N)C2CCOCC2)CC(C)O1.Cl |
| InChI | InChI=1S/C14H26N2O3.ClH/c1-3-12-9-16(8-10(2)19-12)14(17)13(15)11-4-6-18-7-5-11;/h10-13H,3-9,15H2,1-2H3;1H |
| InChIKey | YLNAWZQVHKYPQT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.83 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |