C14H27ClN2O3 — CID 120791201
2-amino-2-(oxan-4-yl)-N-[1-(oxolan-2-yl)propan-2-yl]acetamide;hydrochloride (PubChem CID 120791201) has the molecular formula C14H27ClN2O3 and a molecular weight of 306.83 g/mol. Its IUPAC name is 2-amino-2-(oxan-4-yl)-N-[1-(oxolan-2-yl)propan-2-yl]acetamide;hydrochloride.
| Compound Name | 2-amino-2-(oxan-4-yl)-N-[1-(oxolan-2-yl)propan-2-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120791201 |
| Molecular Formula | C14H27ClN2O3 |
| Molecular Weight | 306.83 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-amino-2-(oxan-4-yl)-N-[1-(oxolan-2-yl)propan-2-yl]acetamide;hydrochloride |
| SMILES | CC(CC1CCCO1)NC(=O)C(N)C1CCOCC1.Cl |
| InChI | InChI=1S/C14H26N2O3.ClH/c1-10(9-12-3-2-6-19-12)16-14(17)13(15)11-4-7-18-8-5-11;/h10-13H,2-9,15H2,1H3,(H,16,17);1H |
| InChIKey | RJNUNWSLKARLDJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.83 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |