C16H16ClNO4 — CID 120820663
5-[(4-chlorophenyl)methyl-methylcarbamoyl]-2-ethylfuran-3-carboxylic acid (PubChem CID 120820663) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl-methylcarbamoyl]-2-ethylfuran-3-carboxylic acid.
| Compound Name | 5-[(4-chlorophenyl)methyl-methylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 120820663 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl-methylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)N(C)Cc2ccc(Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C16H16ClNO4/c1-3-13-12(16(20)21)8-14(22-13)15(19)18(2)9-10-4-6-11(17)7-5-10/h4-8H,3,9H2,1-2H3,(H,20,21) |
| InChIKey | YXJXCDQHMUGKJM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |