C16H15Cl2NO4 — CID 120822185
5-[2-(2,4-dichlorophenyl)ethylcarbamoyl]-2-ethylfuran-3-carboxylic acid (PubChem CID 120822185) has the molecular formula C16H15Cl2NO4 and a molecular weight of 356.21 g/mol. Its IUPAC name is 5-[2-(2,4-dichlorophenyl)ethylcarbamoyl]-2-ethylfuran-3-carboxylic acid.
| Compound Name | 5-[2-(2,4-dichlorophenyl)ethylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 120822185 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 5-[2-(2,4-dichlorophenyl)ethylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)NCCc2ccc(Cl)cc2Cl)cc1C(=O)O |
| InChI | InChI=1S/C16H15Cl2NO4/c1-2-13-11(16(21)22)8-14(23-13)15(20)19-6-5-9-3-4-10(17)7-12(9)18/h3-4,7-8H,2,5-6H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | UDVCCUAZDHWMFZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |