C17H16F3NO5 — CID 120821253
2-ethyl-5-[2-[4-(trifluoromethyl)phenoxy]ethylcarbamoyl]furan-3-carboxylic acid (PubChem CID 120821253) has the molecular formula C17H16F3NO5 and a molecular weight of 371.31 g/mol. Its IUPAC name is 2-ethyl-5-[2-[4-(trifluoromethyl)phenoxy]ethylcarbamoyl]furan-3-carboxylic acid.
| Compound Name | 2-ethyl-5-[2-[4-(trifluoromethyl)phenoxy]ethylcarbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 120821253 |
| Molecular Formula | C17H16F3NO5 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-ethyl-5-[2-[4-(trifluoromethyl)phenoxy]ethylcarbamoyl]furan-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)NCCOc2ccc(C(F)(F)F)cc2)cc1C(=O)O |
| InChI | InChI=1S/C17H16F3NO5/c1-2-13-12(16(23)24)9-14(26-13)15(22)21-7-8-25-11-5-3-10(4-6-11)17(18,19)20/h3-6,9H,2,7-8H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | ONBOFCQWEFCZAT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|