C17H17BrFNO4 — CID 120821911
5-[3-(4-bromo-2-fluorophenyl)propylcarbamoyl]-2-ethylfuran-3-carboxylic acid (PubChem CID 120821911) has the molecular formula C17H17BrFNO4 and a molecular weight of 398.23 g/mol. Its IUPAC name is 5-[3-(4-bromo-2-fluorophenyl)propylcarbamoyl]-2-ethylfuran-3-carboxylic acid.
| Compound Name | 5-[3-(4-bromo-2-fluorophenyl)propylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 120821911 |
| Molecular Formula | C17H17BrFNO4 |
| Molecular Weight | 398.23 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 5-[3-(4-bromo-2-fluorophenyl)propylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)NCCCc2ccc(Br)cc2F)cc1C(=O)O |
| InChI | InChI=1S/C17H17BrFNO4/c1-2-14-12(17(22)23)9-15(24-14)16(21)20-7-3-4-10-5-6-11(18)8-13(10)19/h5-6,8-9H,2-4,7H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | QMKNLMUOYYIXRC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|