C18H18FN3O4 — CID 120821778
2-ethyl-5-[2-(4-fluoro-1-methylbenzimidazol-2-yl)ethylcarbamoyl]furan-3-carboxylic acid (PubChem CID 120821778) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is 2-ethyl-5-[2-(4-fluoro-1-methylbenzimidazol-2-yl)ethylcarbamoyl]furan-3-carboxylic acid.
| Compound Name | 2-ethyl-5-[2-(4-fluoro-1-methylbenzimidazol-2-yl)ethylcarbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 120821778 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-ethyl-5-[2-(4-fluoro-1-methylbenzimidazol-2-yl)ethylcarbamoyl]furan-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)NCCc2nc3c(F)cccc3n2C)cc1C(=O)O |
| InChI | InChI=1S/C18H18FN3O4/c1-3-13-10(18(24)25)9-14(26-13)17(23)20-8-7-15-21-16-11(19)5-4-6-12(16)22(15)2/h4-6,9H,3,7-8H2,1-2H3,(H,20,23)(H,24,25) |
| InChIKey | BJGRUMVUSPDBPM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |