C20H28ClN5OS — CID 120823348
[4-(ethylsulfanylmethyl)phenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 120823348) has the molecular formula C20H28ClN5OS and a molecular weight of 422.00 g/mol. Its IUPAC name is [4-(ethylsulfanylmethyl)phenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | [4-(ethylsulfanylmethyl)phenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120823348 |
| Molecular Formula | C20H28ClN5OS |
| Molecular Weight | 422.00 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [4-(ethylsulfanylmethyl)phenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CCSCc1ccc(C(=O)N2CCC(c3nnc4n3CCNC4)CC2)cc1.Cl |
| InChI | InChI=1S/C20H27N5OS.ClH/c1-2-27-14-15-3-5-17(6-4-15)20(26)24-10-7-16(8-11-24)19-23-22-18-13-21-9-12-25(18)19;/h3-6,16,21H,2,7-14H2,1H3;1H |
| InChIKey | SVIHRTWRSDCZOX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.00 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |