C14H20ClN3O2S — CID 120824315
7-methyl-N-[2-(methylamino)propyl]quinoline-8-sulfonamide;hydrochloride (PubChem CID 120824315) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is 7-methyl-N-[2-(methylamino)propyl]quinoline-8-sulfonamide;hydrochloride.
| Compound Name | 7-methyl-N-[2-(methylamino)propyl]quinoline-8-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120824315 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 7-methyl-N-[2-(methylamino)propyl]quinoline-8-sulfonamide;hydrochloride |
| SMILES | CNC(C)CNS(=O)(=O)c1c(C)ccc2cccnc12.Cl |
| InChI | InChI=1S/C14H19N3O2S.ClH/c1-10-6-7-12-5-4-8-16-13(12)14(10)20(18,19)17-9-11(2)15-3;/h4-8,11,15,17H,9H2,1-3H3;1H |
| InChIKey | PCRKYAGVBIJJJB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |