C11H13F2IN2O — CID 120827537
4,5-difluoro-2-iodo-N-[2-(methylamino)propyl]benzamide (PubChem CID 120827537) has the molecular formula C11H13F2IN2O and a molecular weight of 354.14 g/mol. Its IUPAC name is 4,5-difluoro-2-iodo-N-[2-(methylamino)propyl]benzamide.
| Compound Name | 4,5-difluoro-2-iodo-N-[2-(methylamino)propyl]benzamide |
|---|---|
| PubChem CID | 120827537 |
| Molecular Formula | C11H13F2IN2O |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 4,5-difluoro-2-iodo-N-[2-(methylamino)propyl]benzamide |
| SMILES | CNC(C)CNC(=O)c1cc(F)c(F)cc1I |
| InChI | InChI=1S/C11H13F2IN2O/c1-6(15-2)5-16-11(17)7-3-8(12)9(13)4-10(7)14/h3-4,6,15H,5H2,1-2H3,(H,16,17) |
| InChIKey | JIEVPLKBMUFIPJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|