C12H20ClN3O2S — CID 120832947
5-(acetamidomethyl)-N-[2-(methylamino)propyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 120832947) has the molecular formula C12H20ClN3O2S and a molecular weight of 305.83 g/mol. Its IUPAC name is 5-(acetamidomethyl)-N-[2-(methylamino)propyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | 5-(acetamidomethyl)-N-[2-(methylamino)propyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120832947 |
| Molecular Formula | C12H20ClN3O2S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 5-(acetamidomethyl)-N-[2-(methylamino)propyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)c1ccc(CNC(C)=O)s1.Cl |
| InChI | InChI=1S/C12H19N3O2S.ClH/c1-8(13-3)6-15-12(17)11-5-4-10(18-11)7-14-9(2)16;/h4-5,8,13H,6-7H2,1-3H3,(H,14,16)(H,15,17);1H |
| InChIKey | PRBRPPLRUQKJLB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |