C16H19ClFN3O — CID 120838748
5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-(4-fluoro-3-methylphenyl)-1,2,4-oxadiazole;hydrochloride (PubChem CID 120838748) has the molecular formula C16H19ClFN3O and a molecular weight of 323.80 g/mol. Its IUPAC name is 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-(4-fluoro-3-methylphenyl)-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-(4-fluoro-3-methylphenyl)-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 120838748 |
| Molecular Formula | C16H19ClFN3O |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-(4-fluoro-3-methylphenyl)-1,2,4-oxadiazole;hydrochloride |
| SMILES | Cc1cc(-c2noc([C@@]34CCC[C@@H]3CNC4)n2)ccc1F.Cl |
| InChI | InChI=1S/C16H18FN3O.ClH/c1-10-7-11(4-5-13(10)17)14-19-15(21-20-14)16-6-2-3-12(16)8-18-9-16;/h4-5,7,12,18H,2-3,6,8-9H2,1H3;1H/t12-,16-;/m1./s1 |
| InChIKey | SZESYWAJBSWCBF-VQZRABBESA-N |
| XLogP | 3.25 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |