C22H23ClFN3O2 — CID 120840679
5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-[4-[(2-fluorophenoxy)methyl]phenyl]-1,2,4-oxadiazole;hydrochloride (PubChem CID 120840679) has the molecular formula C22H23ClFN3O2 and a molecular weight of 415.90 g/mol. Its IUPAC name is 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-[4-[(2-fluorophenoxy)methyl]phenyl]-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-[4-[(2-fluorophenoxy)methyl]phenyl]-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 120840679 |
| Molecular Formula | C22H23ClFN3O2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-[4-[(2-fluorophenoxy)methyl]phenyl]-1,2,4-oxadiazole;hydrochloride |
| SMILES | Cl.Fc1ccccc1OCc1ccc(-c2noc([C@@]34CCC[C@@H]3CNC4)n2)cc1 |
| InChI | InChI=1S/C22H22FN3O2.ClH/c23-18-5-1-2-6-19(18)27-13-15-7-9-16(10-8-15)20-25-21(28-26-20)22-11-3-4-17(22)12-24-14-22;/h1-2,5-10,17,24H,3-4,11-14H2;1H/t17-,22-;/m1./s1 |
| InChIKey | BZKFYDIETHJHOU-ZSYABCMZSA-N |
| XLogP | 4.52 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |