C13H22ClN3O — CID 120837527
5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-tert-butyl-1,2,4-oxadiazole;hydrochloride (PubChem CID 120837527) has the molecular formula C13H22ClN3O and a molecular weight of 271.79 g/mol. Its IUPAC name is 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-tert-butyl-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-tert-butyl-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 120837527 |
| Molecular Formula | C13H22ClN3O |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-tert-butyl-1,2,4-oxadiazole;hydrochloride |
| SMILES | CC(C)(C)c1noc([C@@]23CCC[C@@H]2CNC3)n1.Cl |
| InChI | InChI=1S/C13H21N3O.ClH/c1-12(2,3)10-15-11(17-16-10)13-6-4-5-9(13)7-14-8-13;/h9,14H,4-8H2,1-3H3;1H/t9-,13-;/m1./s1 |
| InChIKey | YODZDAGAZZVNGT-BDROLASLSA-N |
| XLogP | 2.43 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |