C12H22N4 — CID 120841938
[1-[(2-propan-2-ylpyrazol-3-yl)methyl]pyrrolidin-2-yl]methanamine (PubChem CID 120841938) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is [1-[(2-propan-2-ylpyrazol-3-yl)methyl]pyrrolidin-2-yl]methanamine.
| Compound Name | [1-[(2-propan-2-ylpyrazol-3-yl)methyl]pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 120841938 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | [1-[(2-propan-2-ylpyrazol-3-yl)methyl]pyrrolidin-2-yl]methanamine |
| SMILES | CC(C)n1nccc1CN1CCCC1CN |
| InChI | InChI=1S/C12H22N4/c1-10(2)16-12(5-6-14-16)9-15-7-3-4-11(15)8-13/h5-6,10-11H,3-4,7-9,13H2,1-2H3 |
| InChIKey | GOAVAECULKSAQK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |