C20H30N4 — CID 120842600
N-[[1-[[4-methyl-2-(2-methylpyrazol-3-yl)phenyl]methyl]piperidin-4-yl]methyl]ethanamine (PubChem CID 120842600) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is N-[[1-[[4-methyl-2-(2-methylpyrazol-3-yl)phenyl]methyl]piperidin-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[[4-methyl-2-(2-methylpyrazol-3-yl)phenyl]methyl]piperidin-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 120842600 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | N-[[1-[[4-methyl-2-(2-methylpyrazol-3-yl)phenyl]methyl]piperidin-4-yl]methyl]ethanamine |
| SMILES | CCNCC1CCN(Cc2ccc(C)cc2-c2ccnn2C)CC1 |
| InChI | InChI=1S/C20H30N4/c1-4-21-14-17-8-11-24(12-9-17)15-18-6-5-16(2)13-19(18)20-7-10-22-23(20)3/h5-7,10,13,17,21H,4,8-9,11-12,14-15H2,1-3H3 |
| InChIKey | YNDMQKDLIPSPDR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |