C18H26N4 — CID 120843400
1-[1-[[4-methyl-2-(2-methylpyrazol-3-yl)phenyl]methyl]pyrrolidin-3-yl]ethanamine (PubChem CID 120843400) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-[1-[[4-methyl-2-(2-methylpyrazol-3-yl)phenyl]methyl]pyrrolidin-3-yl]ethanamine.
| Compound Name | 1-[1-[[4-methyl-2-(2-methylpyrazol-3-yl)phenyl]methyl]pyrrolidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 120843400 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 1-[1-[[4-methyl-2-(2-methylpyrazol-3-yl)phenyl]methyl]pyrrolidin-3-yl]ethanamine |
| SMILES | Cc1ccc(CN2CCC(C(C)N)C2)c(-c2ccnn2C)c1 |
| InChI | InChI=1S/C18H26N4/c1-13-4-5-16(12-22-9-7-15(11-22)14(2)19)17(10-13)18-6-8-20-21(18)3/h4-6,8,10,14-15H,7,9,11-12,19H2,1-3H3 |
| InChIKey | DMAREAVZMMIFJB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |