C18H31ClN4O2 — CID 120844109
ethyl 2-[4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methyl]-3,5-dimethylpyrazol-1-yl]acetate;hydrochloride (PubChem CID 120844109) has the molecular formula C18H31ClN4O2 and a molecular weight of 370.93 g/mol. Its IUPAC name is ethyl 2-[4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methyl]-3,5-dimethylpyrazol-1-yl]acetate;hydrochloride.
| Compound Name | ethyl 2-[4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methyl]-3,5-dimethylpyrazol-1-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 120844109 |
| Molecular Formula | C18H31ClN4O2 |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | ethyl 2-[4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methyl]-3,5-dimethylpyrazol-1-yl]acetate;hydrochloride |
| SMILES | CCOC(=O)Cn1nc(C)c(CN2CC3CCCC(N)C3C2)c1C.Cl |
| InChI | InChI=1S/C18H30N4O2.ClH/c1-4-24-18(23)11-22-13(3)15(12(2)20-22)9-21-8-14-6-5-7-17(19)16(14)10-21;/h14,16-17H,4-11,19H2,1-3H3;1H |
| InChIKey | IWISRUVQCKCTEJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |