C11H14F3N3S — CID 120846149
5-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 120846149) has the molecular formula C11H14F3N3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 5-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-2-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 5-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-2-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 120846149 |
| Molecular Formula | C11H14F3N3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 5-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1ncc(CN2C[C@H]3CNC[C@H]3C2)s1 |
| InChI | InChI=1S/C11H14F3N3S/c12-11(13,14)10-16-3-9(18-10)6-17-4-7-1-15-2-8(7)5-17/h3,7-8,15H,1-2,4-6H2/t7-,8+ |
| InChIKey | DLYIASUMJCGABV-OCAPTIKFSA-N |
| XLogP | 1.81 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |