C14H23N3S — CID 120846164
2-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-tert-butyl-1,3-thiazole (PubChem CID 120846164) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 2-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-tert-butyl-1,3-thiazole.
| Compound Name | 2-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-tert-butyl-1,3-thiazole |
|---|---|
| PubChem CID | 120846164 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-tert-butyl-1,3-thiazole |
| SMILES | CC(C)(C)c1cnc(CN2C[C@H]3CNC[C@H]3C2)s1 |
| InChI | InChI=1S/C14H23N3S/c1-14(2,3)12-6-16-13(18-12)9-17-7-10-4-15-5-11(10)8-17/h6,10-11,15H,4-5,7-9H2,1-3H3/t10-,11+ |
| InChIKey | DDCGWYNYOLNWDJ-PHIMTYICSA-N |
| XLogP | 2.09 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |