C17H24Cl2N2O2 — CID 120853371
ethyl 3-(3,5-dichlorophenyl)-2-(piperidin-4-ylmethylamino)propanoate (PubChem CID 120853371) has the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.30 g/mol. Its IUPAC name is ethyl 3-(3,5-dichlorophenyl)-2-(piperidin-4-ylmethylamino)propanoate.
| Compound Name | ethyl 3-(3,5-dichlorophenyl)-2-(piperidin-4-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 120853371 |
| Molecular Formula | C17H24Cl2N2O2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | ethyl 3-(3,5-dichlorophenyl)-2-(piperidin-4-ylmethylamino)propanoate |
| SMILES | CCOC(=O)C(Cc1cc(Cl)cc(Cl)c1)NCC1CCNCC1 |
| InChI | InChI=1S/C17H24Cl2N2O2/c1-2-23-17(22)16(21-11-12-3-5-20-6-4-12)9-13-7-14(18)10-15(19)8-13/h7-8,10,12,16,20-21H,2-6,9,11H2,1H3 |
| InChIKey | RGDCNGWZLMFKFH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |