C12H20BrClN2S — CID 120855842
1-[2-(5-bromothiophen-2-yl)pyrrolidin-1-yl]-2-methylpropan-2-amine;hydrochloride (PubChem CID 120855842) has the molecular formula C12H20BrClN2S and a molecular weight of 339.73 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)pyrrolidin-1-yl]-2-methylpropan-2-amine;hydrochloride.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)pyrrolidin-1-yl]-2-methylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 120855842 |
| Molecular Formula | C12H20BrClN2S |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)pyrrolidin-1-yl]-2-methylpropan-2-amine;hydrochloride |
| SMILES | CC(C)(N)CN1CCCC1c1ccc(Br)s1.Cl |
| InChI | InChI=1S/C12H19BrN2S.ClH/c1-12(2,14)8-15-7-3-4-9(15)10-5-6-11(13)16-10;/h5-6,9H,3-4,7-8,14H2,1-2H3;1H |
| InChIKey | NRQQTRLQNCMJCW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |