C9H12BrNO2S2 — CID 124885695
(2S)-2-(5-bromothiophen-2-yl)-1-methylsulfonylpyrrolidine (PubChem CID 124885695) has the molecular formula C9H12BrNO2S2 and a molecular weight of 310.24 g/mol. Its IUPAC name is (2S)-2-(5-bromothiophen-2-yl)-1-methylsulfonylpyrrolidine.
| Compound Name | (2S)-2-(5-bromothiophen-2-yl)-1-methylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 124885695 |
| Molecular Formula | C9H12BrNO2S2 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 308.95 |
| IUPAC Name | (2S)-2-(5-bromothiophen-2-yl)-1-methylsulfonylpyrrolidine |
| SMILES | CS(=O)(=O)N1CCC[C@H]1c1ccc(Br)s1 |
| InChI | InChI=1S/C9H12BrNO2S2/c1-15(12,13)11-6-2-3-7(11)8-4-5-9(10)14-8/h4-5,7H,2-3,6H2,1H3/t7-/m0/s1 |
| InChIKey | LIUNCFKKCXVZIP-ZETCQYMHSA-N |
| XLogP | 2.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |